C21H21N3O2S — CID 87406747
N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 87406747) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87406747 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Oc3ccccc3)cc2)cs1)C1CCNCC1 |
| InChI | InChI=1S/C21H21N3O2S/c25-20(16-10-12-22-13-11-16)24-21-23-19(14-27-21)15-6-8-18(9-7-15)26-17-4-2-1-3-5-17/h1-9,14,16,22H,10-13H2,(H,23,24,25) |
| InChIKey | JUMWIFBALPOMLD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |