C18H11FN2O2S — CID 46629048
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 46629048) has the molecular formula C18H11FN2O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 46629048 |
| Molecular Formula | C18H11FN2O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc(F)c2)cs1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H11FN2O2S/c19-13-6-3-5-11(8-13)14-10-24-18(20-14)21-17(22)16-9-12-4-1-2-7-15(12)23-16/h1-10H,(H,20,21,22) |
| InChIKey | LPCWMJPMUIVJKS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |