C14H9FN4OS — CID 36539472
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide (PubChem CID 36539472) has the molecular formula C14H9FN4OS and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 36539472 |
| Molecular Formula | C14H9FN4OS |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc(F)c2)cs1)c1cnccn1 |
| InChI | InChI=1S/C14H9FN4OS/c15-10-3-1-2-9(6-10)12-8-21-14(18-12)19-13(20)11-7-16-4-5-17-11/h1-8H,(H,18,19,20) |
| InChIKey | PPUWHMMULOGLOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |