C15H10FN3OS2 — CID 134012243
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 134012243) has the molecular formula C15H10FN3OS2 and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134012243 |
| Molecular Formula | C15H10FN3OS2 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc(F)c2)cs1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C15H10FN3OS2/c16-10-4-1-3-9(7-10)12-8-22-15(18-12)19-13(20)11-5-2-6-17-14(11)21/h1-8H,(H,17,21)(H,18,19,20) |
| InChIKey | LYIDWHNKNZFWPE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|