C17H13FN2O3S2 — CID 32623148
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-methylsulfonylbenzamide (PubChem CID 32623148) has the molecular formula C17H13FN2O3S2 and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-methylsulfonylbenzamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 32623148 |
| Molecular Formula | C17H13FN2O3S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2nc(-c3cccc(F)c3)cs2)c1 |
| InChI | InChI=1S/C17H13FN2O3S2/c1-25(22,23)14-7-3-5-12(9-14)16(21)20-17-19-15(10-24-17)11-4-2-6-13(18)8-11/h2-10H,1H3,(H,19,20,21) |
| InChIKey | ZSKAUIMGXJFTHE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |