C17H14FN3O3S2 — CID 51112118
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methanesulfonamido)benzamide (PubChem CID 51112118) has the molecular formula C17H14FN3O3S2 and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 51112118 |
| Molecular Formula | C17H14FN3O3S2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2nc(-c3cccc(F)c3)cs2)cc1 |
| InChI | InChI=1S/C17H14FN3O3S2/c1-26(23,24)21-14-7-5-11(6-8-14)16(22)20-17-19-15(10-25-17)12-3-2-4-13(18)9-12/h2-10,21H,1H3,(H,19,20,22) |
| InChIKey | HRGZLTFXWDWMEM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |