C20H18FN3O3S2 — CID 32622585
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 32622585) has the molecular formula C20H18FN3O3S2 and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 32622585 |
| Molecular Formula | C20H18FN3O3S2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1nc(-c2cccc(F)c2)cs1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H18FN3O3S2/c21-16-5-3-4-15(12-16)18-13-28-20(22-18)23-19(25)14-6-8-17(9-7-14)29(26,27)24-10-1-2-11-24/h3-9,12-13H,1-2,10-11H2,(H,22,23,25) |
| InChIKey | FSCPEBAETHGKQE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |