C18H15FN2O3S2 — CID 36539422
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 36539422) has the molecular formula C18H15FN2O3S2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 36539422 |
| Molecular Formula | C18H15FN2O3S2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2nc(-c3cccc(F)c3)cs2)cc1 |
| InChI | InChI=1S/C18H15FN2O3S2/c1-26(23,24)11-12-5-7-13(8-6-12)17(22)21-18-20-16(10-25-18)14-3-2-4-15(19)9-14/h2-10H,11H2,1H3,(H,20,21,22) |
| InChIKey | BMPMTDZNLYSTIP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |