C18H16N2O3S2 — CID 27666286
3-(methylsulfonylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 27666286) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-(methylsulfonylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(methylsulfonylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 27666286 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-(methylsulfonylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-25(22,23)12-13-6-5-9-15(10-13)17(21)20-18-19-16(11-24-18)14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,19,20,21) |
| InChIKey | NZBDVSCBWVJBDH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |