C24H20N2O3S2 — CID 16799686
N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-4-methylsulfonylbenzamide (PubChem CID 16799686) has the molecular formula C24H20N2O3S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-4-methylsulfonylbenzamide.
| Compound Name | N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 16799686 |
| Molecular Formula | C24H20N2O3S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(Cc4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H20N2O3S2/c1-31(28,29)21-13-11-20(12-14-21)23(27)26-24-25-22(16-30-24)19-9-7-18(8-10-19)15-17-5-3-2-4-6-17/h2-14,16H,15H2,1H3,(H,25,26,27) |
| InChIKey | LKNZCGYBVSXBTE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |