C30H33N3O3S2 — CID 3359761
4-(dibutylsulfamoyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 3359761) has the molecular formula C30H33N3O3S2 and a molecular weight of 547.75 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3359761 |
| Molecular Formula | C30H33N3O3S2 |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(-c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C30H33N3O3S2/c1-3-5-20-33(21-6-4-2)38(35,36)27-18-16-26(17-19-27)29(34)32-30-31-28(22-37-30)25-14-12-24(13-15-25)23-10-8-7-9-11-23/h7-19,22H,3-6,20-21H2,1-2H3,(H,31,32,34) |
| InChIKey | DZYKBADTCRTOTH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |