C21H22FN3O3S2 — CID 5129133
4-[butyl(methyl)sulfamoyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 5129133) has the molecular formula C21H22FN3O3S2 and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-[butyl(methyl)sulfamoyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[butyl(methyl)sulfamoyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5129133 |
| Molecular Formula | C21H22FN3O3S2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-[butyl(methyl)sulfamoyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H22FN3O3S2/c1-3-4-13-25(2)30(27,28)18-11-7-16(8-12-18)20(26)24-21-23-19(14-29-21)15-5-9-17(22)10-6-15/h5-12,14H,3-4,13H2,1-2H3,(H,23,24,26) |
| InChIKey | WGNYFJGGELLHOB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |