C27H35N3O4S2 — CID 4098935
4-(dibutylsulfamoyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4098935) has the molecular formula C27H35N3O4S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4098935 |
| Molecular Formula | C27H35N3O4S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(OCCC)cc3)cs2)cc1 |
| InChI | InChI=1S/C27H35N3O4S2/c1-4-7-17-30(18-8-5-2)36(32,33)24-15-11-22(12-16-24)26(31)29-27-28-25(20-35-27)21-9-13-23(14-10-21)34-19-6-3/h9-16,20H,4-8,17-19H2,1-3H3,(H,28,29,31) |
| InChIKey | NQWFRRXQZGJJLW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |