C27H33N3O4S2 — CID 4501198
4-heptoxy-N-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4501198) has the molecular formula C27H33N3O4S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is 4-heptoxy-N-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-heptoxy-N-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4501198 |
| Molecular Formula | C27H33N3O4S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 4-heptoxy-N-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2nc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C27H33N3O4S2/c1-2-3-4-5-8-19-34-23-13-9-22(10-14-23)26(31)29-27-28-25(20-35-27)21-11-15-24(16-12-21)36(32,33)30-17-6-7-18-30/h9-16,20H,2-8,17-19H2,1H3,(H,28,29,31) |
| InChIKey | NJCVSSXJVCAXRB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|