C27H33N3O5S2 — CID 4500684
4-heptoxy-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4500684) has the molecular formula C27H33N3O5S2 and a molecular weight of 543.71 g/mol. Its IUPAC name is 4-heptoxy-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-heptoxy-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4500684 |
| Molecular Formula | C27H33N3O5S2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 4-heptoxy-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2nc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C27H33N3O5S2/c1-2-3-4-5-6-17-35-23-11-7-22(8-12-23)26(31)29-27-28-25(20-36-27)21-9-13-24(14-10-21)37(32,33)30-15-18-34-19-16-30/h7-14,20H,2-6,15-19H2,1H3,(H,28,29,31) |
| InChIKey | MGZHVHMCPPHOLJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|