C24H31N3O6S — CID 24677372
4-hexoxy-N'-(4-morpholin-4-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 24677372) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is 4-hexoxy-N'-(4-morpholin-4-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 4-hexoxy-N'-(4-morpholin-4-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 24677372 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 4-hexoxy-N'-(4-morpholin-4-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O6S/c1-2-3-4-5-16-33-21-10-6-19(7-11-21)23(28)25-26-24(29)20-8-12-22(13-9-20)34(30,31)27-14-17-32-18-15-27/h6-13H,2-5,14-18H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | CWLMLBVYEONTRU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|