C25H22N2O3S2 — CID 41028740
N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-3-ethylsulfonylbenzamide (PubChem CID 41028740) has the molecular formula C25H22N2O3S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-3-ethylsulfonylbenzamide.
| Compound Name | N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-3-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 41028740 |
| Molecular Formula | C25H22N2O3S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-3-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1cccc(C(=O)Nc2nc(-c3ccc(Cc4ccccc4)cc3)cs2)c1 |
| InChI | InChI=1S/C25H22N2O3S2/c1-2-32(29,30)22-10-6-9-21(16-22)24(28)27-25-26-23(17-31-25)20-13-11-19(12-14-20)15-18-7-4-3-5-8-18/h3-14,16-17H,2,15H2,1H3,(H,26,27,28) |
| InChIKey | RZLCFKISVHUILH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |