C21H21N3O3S2 — CID 46667861
3-(cyclopropylsulfamoyl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 46667861) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46667861 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)c3cccc(S(=O)(=O)NC4CC4)c3)n2)cc1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-2-14-6-8-15(9-7-14)19-13-28-21(22-19)23-20(25)16-4-3-5-18(12-16)29(26,27)24-17-10-11-17/h3-9,12-13,17,24H,2,10-11H2,1H3,(H,22,23,25) |
| InChIKey | YVYPFQZYRPNAAC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |