C23H18ClN3O3S2 — CID 4653870
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 4653870) has the molecular formula C23H18ClN3O3S2 and a molecular weight of 484.00 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4653870 |
| Molecular Formula | C23H18ClN3O3S2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)c1 |
| InChI | InChI=1S/C23H18ClN3O3S2/c1-27(19-7-3-2-4-8-19)32(29,30)20-9-5-6-17(14-20)22(28)26-23-25-21(15-31-23)16-10-12-18(24)13-11-16/h2-15H,1H3,(H,25,26,28) |
| InChIKey | AVSSEOPVCQQSIT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |