C21H20ClN3O3S2 — CID 3492947
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 3492947) has the molecular formula C21H20ClN3O3S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3492947 |
| Molecular Formula | C21H20ClN3O3S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2)cs1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H20ClN3O3S2/c22-17-9-7-15(8-10-17)19-14-29-21(23-19)24-20(26)16-5-4-6-18(13-16)30(27,28)25-11-2-1-3-12-25/h4-10,13-14H,1-3,11-12H2,(H,23,24,26) |
| InChIKey | XQYLXXRFOMNASU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |