C18H22N4O4S2 — CID 24584483
N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-(azepan-1-ylsulfonyl)benzamide (PubChem CID 24584483) has the molecular formula C18H22N4O4S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-(azepan-1-ylsulfonyl)benzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-(azepan-1-ylsulfonyl)benzamide |
|---|---|
| PubChem CID | 24584483 |
| Molecular Formula | C18H22N4O4S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-(azepan-1-ylsulfonyl)benzamide |
| SMILES | NC(=O)Cc1csc(NC(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)n1 |
| InChI | InChI=1S/C18H22N4O4S2/c19-16(23)11-14-12-27-18(20-14)21-17(24)13-6-5-7-15(10-13)28(25,26)22-8-3-1-2-4-9-22/h5-7,10,12H,1-4,8-9,11H2,(H2,19,23)(H,20,21,24) |
| InChIKey | QRLDPSLQJWLQGH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |