C16H9BrF2N2OS — CID 112760887
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzamide (PubChem CID 112760887) has the molecular formula C16H9BrF2N2OS and a molecular weight of 395.23 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 112760887 |
| Molecular Formula | C16H9BrF2N2OS |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1nc(-c2cccc(Br)c2)cs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H9BrF2N2OS/c17-10-3-1-2-9(6-10)14-8-23-16(20-14)21-15(22)12-5-4-11(18)7-13(12)19/h1-8H,(H,20,21,22) |
| InChIKey | AEJAQNVUDQCUKJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |