C16H10BrFN2OS — CID 26687571
4-bromo-2-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 26687571) has the molecular formula C16H10BrFN2OS and a molecular weight of 377.24 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-bromo-2-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 26687571 |
| Molecular Formula | C16H10BrFN2OS |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 4-bromo-2-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H10BrFN2OS/c17-11-6-7-12(13(18)8-11)15(21)20-16-19-14(9-22-16)10-4-2-1-3-5-10/h1-9H,(H,19,20,21) |
| InChIKey | DXRFVWKCDTXRCD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |