C17H10BrF3N2OS — CID 26249519
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 26249519) has the molecular formula C17H10BrF3N2OS and a molecular weight of 427.25 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 26249519 |
| Molecular Formula | C17H10BrF3N2OS |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(Br)cc2)cs1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H10BrF3N2OS/c18-11-7-5-10(6-8-11)14-9-25-16(22-14)23-15(24)12-3-1-2-4-13(12)17(19,20)21/h1-9H,(H,22,23,24) |
| InChIKey | XBDKEFWLGKLKGV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |