C14H9BrN2OS2 — CID 1179161
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 1179161) has the molecular formula C14H9BrN2OS2 and a molecular weight of 365.28 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1179161 |
| Molecular Formula | C14H9BrN2OS2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc(Br)c2)cs1)c1cccs1 |
| InChI | InChI=1S/C14H9BrN2OS2/c15-10-4-1-3-9(7-10)11-8-20-14(16-11)17-13(18)12-5-2-6-19-12/h1-8H,(H,16,17,18) |
| InChIKey | GBNUIQGALPMSTO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |