C15H11BrN2OS2 — CID 55334183
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 55334183) has the molecular formula C15H11BrN2OS2 and a molecular weight of 379.30 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 55334183 |
| Molecular Formula | C15H11BrN2OS2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C15H11BrN2OS2/c16-11-4-1-3-10(7-11)13-9-21-15(17-13)18-14(19)8-12-5-2-6-20-12/h1-7,9H,8H2,(H,17,18,19) |
| InChIKey | BIFXEZAIQGDLTA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|