C10H10N2OS2 — CID 6486768
N-(4-methyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide (PubChem CID 6486768) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 6486768 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide |
| SMILES | Cc1csc(NC(=O)Cc2cccs2)n1 |
| InChI | InChI=1S/C10H10N2OS2/c1-7-6-15-10(11-7)12-9(13)5-8-3-2-4-14-8/h2-4,6H,5H2,1H3,(H,11,12,13) |
| InChIKey | IXEVWVGBDQWRGB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|