C14H12N2O2S — CID 110463883
2-(1-benzofuran-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 110463883) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(1-benzofuran-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110463883 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(NC(=O)Cc2coc3ccccc23)n1 |
| InChI | InChI=1S/C14H12N2O2S/c1-9-8-19-14(15-9)16-13(17)6-10-7-18-12-5-3-2-4-11(10)12/h2-5,7-8H,6H2,1H3,(H,15,16,17) |
| InChIKey | LJWURQBVMGTPMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |