C16H16BN3O5S — CID 174046947
[2-(1-benzofuran-3-yl)-1-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]ethyl]boronic acid (PubChem CID 174046947) has the molecular formula C16H16BN3O5S and a molecular weight of 373.20 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 174046947 |
| Molecular Formula | C16H16BN3O5S |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]ethyl]boronic acid |
| SMILES | Cc1csc(NC(=O)C(=O)NC(Cc2coc3ccccc23)B(O)O)n1 |
| InChI | InChI=1S/C16H16BN3O5S/c1-9-8-26-16(18-9)20-15(22)14(21)19-13(17(23)24)6-10-7-25-12-5-3-2-4-11(10)12/h2-5,7-8,13,23-24H,6H2,1H3,(H,19,21)(H,18,20,22) |
| InChIKey | HEQTXZLEVJWGHH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|