C18H21BN2O6 — CID 174046918
[2-(1-benzofuran-3-yl)-1-[[2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-2-oxoacetyl]amino]ethyl]boronic acid (PubChem CID 174046918) has the molecular formula C18H21BN2O6 and a molecular weight of 372.19 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-2-oxoacetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-2-oxoacetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 174046918 |
| Molecular Formula | C18H21BN2O6 |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-2-oxoacetyl]amino]ethyl]boronic acid |
| SMILES | O=C(NC(Cc1coc2ccccc12)B(O)O)C(=O)NC1CC2CCC1O2 |
| InChI | InChI=1S/C18H21BN2O6/c22-17(20-13-8-11-5-6-15(13)27-11)18(23)21-16(19(24)25)7-10-9-26-14-4-2-1-3-12(10)14/h1-4,9,11,13,15-16,24-25H,5-8H2,(H,20,22)(H,21,23) |
| InChIKey | SCKYDPKKGAEFLB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|