C19H26BNO4 — CID 71617118
[(1R)-2-(1-benzofuran-3-yl)-1-(3-cyclohexylpropanoylamino)ethyl]boronic acid (PubChem CID 71617118) has the molecular formula C19H26BNO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-(3-cyclohexylpropanoylamino)ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-(3-cyclohexylpropanoylamino)ethyl]boronic acid |
|---|---|
| PubChem CID | 71617118 |
| Molecular Formula | C19H26BNO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-(3-cyclohexylpropanoylamino)ethyl]boronic acid |
| SMILES | O=C(CCC1CCCCC1)N[C@@H](Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C19H26BNO4/c22-19(11-10-14-6-2-1-3-7-14)21-18(20(23)24)12-15-13-25-17-9-5-4-8-16(15)17/h4-5,8-9,13-14,18,23-24H,1-3,6-7,10-12H2,(H,21,22)/t18-/m0/s1 |
| InChIKey | QYNYXQVRAYCMEM-SFHVURJKSA-N |
| XLogP | 2.83 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|