C19H17BN2O4 — CID 147953274
[2-(1-benzofuran-3-yl)-1-[[2-(4-cyanophenyl)acetyl]amino]ethyl]boronic acid (PubChem CID 147953274) has the molecular formula C19H17BN2O4 and a molecular weight of 348.17 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-(4-cyanophenyl)acetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-(4-cyanophenyl)acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 147953274 |
| Molecular Formula | C19H17BN2O4 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-(4-cyanophenyl)acetyl]amino]ethyl]boronic acid |
| SMILES | N#Cc1ccc(CC(=O)NC(Cc2coc3ccccc23)B(O)O)cc1 |
| InChI | InChI=1S/C19H17BN2O4/c21-11-14-7-5-13(6-8-14)9-19(23)22-18(20(24)25)10-15-12-26-17-4-2-1-3-16(15)17/h1-8,12,18,24-25H,9-10H2,(H,22,23) |
| InChIKey | IOAPBTWXHZBVKL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|