C15H18BNO5 — CID 159415789
[(1R)-2-(1-benzofuran-3-yl)-1-[[(3R)-oxolane-3-carbonyl]amino]ethyl]boronic acid (PubChem CID 159415789) has the molecular formula C15H18BNO5 and a molecular weight of 303.12 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(3R)-oxolane-3-carbonyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(3R)-oxolane-3-carbonyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 159415789 |
| Molecular Formula | C15H18BNO5 |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(3R)-oxolane-3-carbonyl]amino]ethyl]boronic acid |
| SMILES | O=C(N[C@@H](Cc1coc2ccccc12)B(O)O)[C@@H]1CCOC1 |
| InChI | InChI=1S/C15H18BNO5/c18-15(10-5-6-21-8-10)17-14(16(19)20)7-11-9-22-13-4-2-1-3-12(11)13/h1-4,9-10,14,19-20H,5-8H2,(H,17,18)/t10-,14+/m1/s1 |
| InChIKey | LPDJLONKZFUKOX-YGRLFVJLSA-N |
| XLogP | 0.51 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|