C19H20BNO4 — CID 78135487
[2-(1-benzofuran-3-yl)-1-(3-phenylpropanoylamino)ethyl]boronic acid (PubChem CID 78135487) has the molecular formula C19H20BNO4 and a molecular weight of 337.18 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-(3-phenylpropanoylamino)ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-(3-phenylpropanoylamino)ethyl]boronic acid |
|---|---|
| PubChem CID | 78135487 |
| Molecular Formula | C19H20BNO4 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-(3-phenylpropanoylamino)ethyl]boronic acid |
| SMILES | O=C(CCc1ccccc1)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C19H20BNO4/c22-19(11-10-14-6-2-1-3-7-14)21-18(20(23)24)12-15-13-25-17-9-5-4-8-16(15)17/h1-9,13,18,23-24H,10-12H2,(H,21,22) |
| InChIKey | WRDRUHOPUCWQHZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|