C18H19BN2O4 — CID 78135486
[2-(1-benzofuran-3-yl)-1-(3-pyridin-4-ylpropanoylamino)ethyl]boronic acid (PubChem CID 78135486) has the molecular formula C18H19BN2O4 and a molecular weight of 338.17 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-(3-pyridin-4-ylpropanoylamino)ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-(3-pyridin-4-ylpropanoylamino)ethyl]boronic acid |
|---|---|
| PubChem CID | 78135486 |
| Molecular Formula | C18H19BN2O4 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-(3-pyridin-4-ylpropanoylamino)ethyl]boronic acid |
| SMILES | O=C(CCc1ccncc1)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C18H19BN2O4/c22-18(6-5-13-7-9-20-10-8-13)21-17(19(23)24)11-14-12-25-16-4-2-1-3-15(14)16/h1-4,7-10,12,17,23-24H,5-6,11H2,(H,21,22) |
| InChIKey | AJAJKOLUEYIWCA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|