C22H24BN3O6 — CID 140861715
[(1R)-2-(1-benzofuran-3-yl)-1-[[2-[3-(morpholine-4-carbonyl)-2-pyridinyl]acetyl]amino]ethyl]boronic acid (PubChem CID 140861715) has the molecular formula C22H24BN3O6 and a molecular weight of 437.26 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[2-[3-(morpholine-4-carbonyl)-2-pyridinyl]acetyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[2-[3-(morpholine-4-carbonyl)-2-pyridinyl]acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140861715 |
| Molecular Formula | C22H24BN3O6 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[2-[3-(morpholine-4-carbonyl)-2-pyridinyl]acetyl]amino]ethyl]boronic acid |
| SMILES | O=C(Cc1ncccc1C(=O)N1CCOCC1)N[C@@H](Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C22H24BN3O6/c27-21(13-18-17(5-3-7-24-18)22(28)26-8-10-31-11-9-26)25-20(23(29)30)12-15-14-32-19-6-2-1-4-16(15)19/h1-7,14,20,29-30H,8-13H2,(H,25,27)/t20-/m0/s1 |
| InChIKey | KFEZAWJICFGUNC-FQEVSTJZSA-N |
| XLogP | 0.58 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|