C17H19BF2N2O5 — CID 174046930
[2-(1-benzofuran-3-yl)-1-[[2-(3,3-difluoropiperidin-1-yl)-2-oxoacetyl]amino]ethyl]boronic acid (PubChem CID 174046930) has the molecular formula C17H19BF2N2O5 and a molecular weight of 380.16 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-(3,3-difluoropiperidin-1-yl)-2-oxoacetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-(3,3-difluoropiperidin-1-yl)-2-oxoacetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 174046930 |
| Molecular Formula | C17H19BF2N2O5 |
| Molecular Weight | 380.16 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-(3,3-difluoropiperidin-1-yl)-2-oxoacetyl]amino]ethyl]boronic acid |
| SMILES | O=C(NC(Cc1coc2ccccc12)B(O)O)C(=O)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C17H19BF2N2O5/c19-17(20)6-3-7-22(10-17)16(24)15(23)21-14(18(25)26)8-11-9-27-13-5-2-1-4-12(11)13/h1-2,4-5,9,14,25-26H,3,6-8,10H2,(H,21,23) |
| InChIKey | RBKBZGQZPPJRIE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|