C18H16BCl2NO4 — CID 145054166
[2-(1-benzofuran-3-yl)-1-[[2-(2,6-dichlorophenyl)acetyl]amino]ethyl]boronic acid (PubChem CID 145054166) has the molecular formula C18H16BCl2NO4 and a molecular weight of 392.05 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-(2,6-dichlorophenyl)acetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-(2,6-dichlorophenyl)acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 145054166 |
| Molecular Formula | C18H16BCl2NO4 |
| Molecular Weight | 392.05 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-(2,6-dichlorophenyl)acetyl]amino]ethyl]boronic acid |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C18H16BCl2NO4/c20-14-5-3-6-15(21)13(14)9-18(23)22-17(19(24)25)8-11-10-26-16-7-2-1-4-12(11)16/h1-7,10,17,24-25H,8-9H2,(H,22,23) |
| InChIKey | JEOCNWDHQOBJCK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.05 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|