C14H17BN2O6 — CID 175583141
[2-(1-benzofuran-3-yl)-1-[[2-[methoxy(methyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid (PubChem CID 175583141) has the molecular formula C14H17BN2O6 and a molecular weight of 320.11 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-[methoxy(methyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-[methoxy(methyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 175583141 |
| Molecular Formula | C14H17BN2O6 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-[methoxy(methyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid |
| SMILES | CON(C)C(=O)C(=O)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C14H17BN2O6/c1-17(22-2)14(19)13(18)16-12(15(20)21)7-9-8-23-11-6-4-3-5-10(9)11/h3-6,8,12,20-21H,7H2,1-2H3,(H,16,18) |
| InChIKey | LRMBNFUOHUGWJO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|