C18H15BCl2N2O5 — CID 174046897
[2-(1-benzofuran-3-yl)-1-[[2-(2,5-dichloroanilino)-2-oxoacetyl]amino]ethyl]boronic acid (PubChem CID 174046897) has the molecular formula C18H15BCl2N2O5 and a molecular weight of 421.05 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-(2,5-dichloroanilino)-2-oxoacetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-(2,5-dichloroanilino)-2-oxoacetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 174046897 |
| Molecular Formula | C18H15BCl2N2O5 |
| Molecular Weight | 421.05 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-(2,5-dichloroanilino)-2-oxoacetyl]amino]ethyl]boronic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C(=O)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C18H15BCl2N2O5/c20-11-5-6-13(21)14(8-11)22-17(24)18(25)23-16(19(26)27)7-10-9-28-15-4-2-1-3-12(10)15/h1-6,8-9,16,26-27H,7H2,(H,22,24)(H,23,25) |
| InChIKey | TWRMQJDIIAUAEC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.05 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|