C17H21BN2O5 — CID 145054027
[2-(1-benzofuran-3-yl)-1-[3-(2-oxopyrrolidin-1-yl)propanoylamino]ethyl]boronic acid (PubChem CID 145054027) has the molecular formula C17H21BN2O5 and a molecular weight of 344.18 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[3-(2-oxopyrrolidin-1-yl)propanoylamino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[3-(2-oxopyrrolidin-1-yl)propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 145054027 |
| Molecular Formula | C17H21BN2O5 |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[3-(2-oxopyrrolidin-1-yl)propanoylamino]ethyl]boronic acid |
| SMILES | O=C(CCN1CCCC1=O)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C17H21BN2O5/c21-16(7-9-20-8-3-6-17(20)22)19-15(18(23)24)10-12-11-25-14-5-2-1-4-13(12)14/h1-2,4-5,11,15,23-24H,3,6-10H2,(H,19,21) |
| InChIKey | KLEUVJSQTIKBHS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|