C19H25BN2O6 — CID 145054023
[2-(6H-cyclohepta[b]furan-3-yl)-1-[3-(5-oxo-1,4-oxazepan-4-yl)propanoylamino]ethyl]boronic acid (PubChem CID 145054023) has the molecular formula C19H25BN2O6 and a molecular weight of 388.23 g/mol. Its IUPAC name is [2-(6H-cyclohepta[b]furan-3-yl)-1-[3-(5-oxo-1,4-oxazepan-4-yl)propanoylamino]ethyl]boronic acid.
| Compound Name | [2-(6H-cyclohepta[b]furan-3-yl)-1-[3-(5-oxo-1,4-oxazepan-4-yl)propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 145054023 |
| Molecular Formula | C19H25BN2O6 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [2-(6H-cyclohepta[b]furan-3-yl)-1-[3-(5-oxo-1,4-oxazepan-4-yl)propanoylamino]ethyl]boronic acid |
| SMILES | O=C(CCN1CCOCCC1=O)NC(Cc1coc2c1C=CCC=C2)B(O)O |
| InChI | InChI=1S/C19H25BN2O6/c23-18(6-8-22-9-11-27-10-7-19(22)24)21-17(20(25)26)12-14-13-28-16-5-3-1-2-4-15(14)16/h2-5,13,17,25-26H,1,6-12H2,(H,21,23) |
| InChIKey | BMQIIKSFIKVEGW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|