C18H27BN2O4 — CID 153158776
[2-(2,4-dimethylphenyl)-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid (PubChem CID 153158776) has the molecular formula C18H27BN2O4 and a molecular weight of 346.24 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid.
| Compound Name | [2-(2,4-dimethylphenyl)-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 153158776 |
| Molecular Formula | C18H27BN2O4 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid |
| SMILES | Cc1ccc(CC(NC(=O)CCN2CCCCC2=O)B(O)O)c(C)c1 |
| InChI | InChI=1S/C18H27BN2O4/c1-13-6-7-15(14(2)11-13)12-16(19(24)25)20-17(22)8-10-21-9-4-3-5-18(21)23/h6-7,11,16,24-25H,3-5,8-10,12H2,1-2H3,(H,20,22) |
| InChIKey | WBXXDPGDRXIQDC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|