C20H25BN2O4 — CID 140880189
[(1R)-2-naphthalen-1-yl-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid (PubChem CID 140880189) has the molecular formula C20H25BN2O4 and a molecular weight of 368.24 g/mol. Its IUPAC name is [(1R)-2-naphthalen-1-yl-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-naphthalen-1-yl-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140880189 |
| Molecular Formula | C20H25BN2O4 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [(1R)-2-naphthalen-1-yl-1-[3-(2-oxopiperidin-1-yl)propanoylamino]ethyl]boronic acid |
| SMILES | O=C(CCN1CCCCC1=O)N[C@@H](Cc1cccc2ccccc12)B(O)O |
| InChI | InChI=1S/C20H25BN2O4/c24-19(11-13-23-12-4-3-10-20(23)25)22-18(21(26)27)14-16-8-5-7-15-6-1-2-9-17(15)16/h1-2,5-9,18,26-27H,3-4,10-14H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | BHAGHLXSAMHHFC-SFHVURJKSA-N |
| XLogP | 1.28 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|