C20H27BN2O3 — CID 147107094
[1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-2-(2,4-dimethylphenyl)ethyl]boronic acid (PubChem CID 147107094) has the molecular formula C20H27BN2O3 and a molecular weight of 354.26 g/mol. Its IUPAC name is [1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-2-(2,4-dimethylphenyl)ethyl]boronic acid.
| Compound Name | [1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-2-(2,4-dimethylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 147107094 |
| Molecular Formula | C20H27BN2O3 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-2-(2,4-dimethylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(CC(NC(=O)Cc2ccc(N(C)C)cc2)B(O)O)c(C)c1 |
| InChI | InChI=1S/C20H27BN2O3/c1-14-5-8-17(15(2)11-14)13-19(21(25)26)22-20(24)12-16-6-9-18(10-7-16)23(3)4/h5-11,19,25-26H,12-13H2,1-4H3,(H,22,24) |
| InChIKey | BLTZKSHAGJKOIH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|