C22H27BN2O4 — CID 140880267
[(1R)-2-(2,4-dimethylphenyl)-1-[[(2S)-2-(N-prop-2-enoylanilino)propanoyl]amino]ethyl]boronic acid (PubChem CID 140880267) has the molecular formula C22H27BN2O4 and a molecular weight of 394.28 g/mol. Its IUPAC name is [(1R)-2-(2,4-dimethylphenyl)-1-[[(2S)-2-(N-prop-2-enoylanilino)propanoyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(2,4-dimethylphenyl)-1-[[(2S)-2-(N-prop-2-enoylanilino)propanoyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140880267 |
| Molecular Formula | C22H27BN2O4 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(1R)-2-(2,4-dimethylphenyl)-1-[[(2S)-2-(N-prop-2-enoylanilino)propanoyl]amino]ethyl]boronic acid |
| SMILES | C=CC(=O)N(c1ccccc1)[C@@H](C)C(=O)N[C@@H](Cc1ccc(C)cc1C)B(O)O |
| InChI | InChI=1S/C22H27BN2O4/c1-5-21(26)25(19-9-7-6-8-10-19)17(4)22(27)24-20(23(28)29)14-18-12-11-15(2)13-16(18)3/h5-13,17,20,28-29H,1,14H2,2-4H3,(H,24,27)/t17-,20-/m0/s1 |
| InChIKey | HTOOECRGUZKKEH-PXNSSMCTSA-N |
| XLogP | 1.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|