(2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid

C12H16O2 — CID 96752041

IUPAC(2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid
SMILESCc1ccc(C[C@@H](C)C(=O)O)c(C)c1
InChIInChI=1S/C12H16O2/c1-8-4-5-11(9(2)6-8)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14)/t10-/m1/s1
InChIKeyTVAGSCAXJSENSY-SNVBAGLBSA-N
MW192.26 g/mol
LogP2.57
Rot. Bonds3

About (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid

(2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid (PubChem CID 96752041) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid.

Molecular Properties

Compound Name(2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid
PubChem CID96752041
Molecular FormulaC12H16O2
Molecular Weight192.26 g/mol
Exact Mass192.12
IUPAC Name(2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid
SMILESCc1ccc(C[C@@H](C)C(=O)O)c(C)c1
InChIInChI=1S/C12H16O2/c1-8-4-5-11(9(2)6-8)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14)/t10-/m1/s1
InChIKeyTVAGSCAXJSENSY-SNVBAGLBSA-N
XLogP2.57
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.26
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid?
The IUPAC name of (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid (CID 96752041) is (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid.
What is the SMILES notation for (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid?
The canonical SMILES for (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid is Cc1ccc(C[C@@H](C)C(=O)O)c(C)c1.
What is the InChIKey of (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid?
The InChIKey is TVAGSCAXJSENSY-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H16O2/c1-8-4-5-11(9(2)6-8)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14)/t10-/m1/s1.
What are the key properties of (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid?
(2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid has a molecular weight of 192.26 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(2,4-dimethylphenyl)-2-methylpropanoic acid is sourced from PubChem (CID 96752041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).