C12H15FO2 — CID 84781211
3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid (PubChem CID 84781211) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84781211 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid |
| SMILES | Cc1cc(C)c(CC(C)C(=O)O)cc1F |
| InChI | InChI=1S/C12H15FO2/c1-7-4-8(2)11(13)6-10(7)5-9(3)12(14)15/h4,6,9H,5H2,1-3H3,(H,14,15) |
| InChIKey | XRNYUCBGNMGBLT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |