3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid

C12H15FO2 — CID 84781211

IUPAC3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid
SMILESCc1cc(C)c(CC(C)C(=O)O)cc1F
InChIInChI=1S/C12H15FO2/c1-7-4-8(2)11(13)6-10(7)5-9(3)12(14)15/h4,6,9H,5H2,1-3H3,(H,14,15)
InChIKeyXRNYUCBGNMGBLT-UHFFFAOYSA-N
MW210.25 g/mol
LogP2.71
Rot. Bonds3

About 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid

3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid (PubChem CID 84781211) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid
PubChem CID84781211
Molecular FormulaC12H15FO2
Molecular Weight210.25 g/mol
Exact Mass210.11
IUPAC Name3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid
SMILESCc1cc(C)c(CC(C)C(=O)O)cc1F
InChIInChI=1S/C12H15FO2/c1-7-4-8(2)11(13)6-10(7)5-9(3)12(14)15/h4,6,9H,5H2,1-3H3,(H,14,15)
InChIKeyXRNYUCBGNMGBLT-UHFFFAOYSA-N
XLogP2.71
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.25
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid?
The IUPAC name of 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid (CID 84781211) is 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid?
The canonical SMILES for 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid is Cc1cc(C)c(CC(C)C(=O)O)cc1F.
What is the InChIKey of 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid?
The InChIKey is XRNYUCBGNMGBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO2/c1-7-4-8(2)11(13)6-10(7)5-9(3)12(14)15/h4,6,9H,5H2,1-3H3,(H,14,15).
What are the key properties of 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid?
3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid has a molecular weight of 210.25 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluoro-2,4-dimethylphenyl)-2-methylpropanoic acid is sourced from PubChem (CID 84781211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).