C12H17F — CID 160613848
1-fluoro-2,4-dimethyl-5-(2-methylpropyl)benzene (PubChem CID 160613848) has the molecular formula C12H17F and a molecular weight of 180.27 g/mol. Its IUPAC name is 1-fluoro-2,4-dimethyl-5-(2-methylpropyl)benzene.
| Compound Name | 1-fluoro-2,4-dimethyl-5-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 160613848 |
| Molecular Formula | C12H17F |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-fluoro-2,4-dimethyl-5-(2-methylpropyl)benzene |
| SMILES | Cc1cc(C)c(CC(C)C)cc1F |
| InChI | InChI=1S/C12H17F/c1-8(2)5-11-7-12(13)10(4)6-9(11)3/h6-8H,5H2,1-4H3 |
| InChIKey | HMMXFHGHRQYPIS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |