C13H23FO — CID 154686554
ethane;(5-fluoro-2,4-dimethylphenyl)methanol (PubChem CID 154686554) has the molecular formula C13H23FO and a molecular weight of 214.32 g/mol. Its IUPAC name is ethane;(5-fluoro-2,4-dimethylphenyl)methanol.
| Compound Name | ethane;(5-fluoro-2,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 154686554 |
| Molecular Formula | C13H23FO |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | ethane;(5-fluoro-2,4-dimethylphenyl)methanol |
| SMILES | CC.CC.Cc1cc(C)c(CO)cc1F |
| InChI | InChI=1S/C9H11FO.2C2H6/c1-6-3-7(2)9(10)4-8(6)5-11;2*1-2/h3-4,11H,5H2,1-2H3;2*1-2H3 |
| InChIKey | GGJGYULSGZAHIL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |